C36H38N4O7 — CID 122185370
[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 2-[(5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carbonyl)amino]propanoate (PubChem CID 122185370) has the molecular formula C36H38N4O7 and a molecular weight of 638.72 g/mol. Its IUPAC name is [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 2-[(5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carbonyl)amino]propanoate.
| Compound Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 2-[(5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 122185370 |
| Molecular Formula | C36H38N4O7 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 2-[(5-ethyl-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carbonyl)amino]propanoate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](OC(=O)C(C)NC(=O)c1cn(CC)c2cc3c(cc2c1=O)OCO3)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C36H38N4O7/c1-5-21-17-40-12-10-22(21)13-30(40)34(24-9-11-37-28-8-7-23(44-4)14-25(24)28)47-36(43)20(3)38-35(42)27-18-39(6-2)29-16-32-31(45-19-46-32)15-26(29)33(27)41/h5,7-9,11,14-16,18,20-22,30,34H,1,6,10,12-13,17,19H2,2-4H3,(H,38,42)/t20?,21-,22-,30-,34+/m0/s1 |
| InChIKey | WTONVWGKOKQSRH-HIWVBPCUSA-N |
| XLogP | 4.61 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|