C23H26ClN3O3 — CID 122185386
1-benzyl-8-[(5-chloro-2-hydroxyphenyl)methyl]-3-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 122185386) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 1-benzyl-8-[(5-chloro-2-hydroxyphenyl)methyl]-3-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-8-[(5-chloro-2-hydroxyphenyl)methyl]-3-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 122185386 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-benzyl-8-[(5-chloro-2-hydroxyphenyl)methyl]-3-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)N(Cc2ccccc2)C2(CCN(Cc3cc(Cl)ccc3O)CC2)C1=O |
| InChI | InChI=1S/C23H26ClN3O3/c1-2-26-21(29)23(27(22(26)30)15-17-6-4-3-5-7-17)10-12-25(13-11-23)16-18-14-19(24)8-9-20(18)28/h3-9,14,28H,2,10-13,15-16H2,1H3 |
| InChIKey | VAZRSCYGXQMCIL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|