C27H32N3NaO10 — CID 122185470
sodium (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-[[2-oxo-2-[(4-phenylphenyl)methylamino]acetyl]amino]propyl]-4-hydroxy-2-methoxyoxane-2-carboxylate (PubChem CID 122185470) has the molecular formula C27H32N3NaO10 and a molecular weight of 581.55 g/mol. Its IUPAC name is sodium (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-[[2-oxo-2-[(4-phenylphenyl)methylamino]acetyl]amino]propyl]-4-hydroxy-2-methoxyoxane-2-carboxylate.
| Compound Name | sodium (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-[[2-oxo-2-[(4-phenylphenyl)methylamino]acetyl]amino]propyl]-4-hydroxy-2-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 122185470 |
| Molecular Formula | C27H32N3NaO10 |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | sodium (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-[[2-oxo-2-[(4-phenylphenyl)methylamino]acetyl]amino]propyl]-4-hydroxy-2-methoxyoxane-2-carboxylate |
| SMILES | CO[C@]1(C(=O)[O-])C[C@H](O)[C@@H](NC(C)=O)[C@H]([C@H](O)[C@H](O)CNC(=O)C(=O)NCc2ccc(-c3ccccc3)cc2)O1.[Na+] |
| InChI | InChI=1S/C27H33N3O10.Na/c1-15(31)30-21-19(32)12-27(39-2,26(37)38)40-23(21)22(34)20(33)14-29-25(36)24(35)28-13-16-8-10-18(11-9-16)17-6-4-3-5-7-17;/h3-11,19-23,32-34H,12-14H2,1-2H3,(H,28,35)(H,29,36)(H,30,31)(H,37,38);/q;+1/p-1/t19-,20+,21+,22+,23+,27+;/m0./s1 |
| InChIKey | MSUNCONYFRDTEK-RMHWWQBPSA-M |
| XLogP | -5.44 |
| TPSA | 206.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | -5.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|