About 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide
4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide (PubChem CID 122185735) has the molecular formula C14H18BrN5O2S
and a molecular weight of 400.30 g/mol. Its IUPAC name is 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide.
Molecular Properties
| Compound Name | 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide |
| PubChem CID | 122185735 |
| Molecular Formula | C14H18BrN5O2S |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide |
| SMILES | C[C@@H](O)[C@@H](C)Nc1nc(Nc2ccc(S(N)=O)cc2)ncc1Br |
| InChI | InChI=1S/C14H18BrN5O2S/c1-8(9(2)21)18-13-12(15)7-17-14(20-13)19-10-3-5-11(6-4-10)23(16)22/h3-9,21H,16H2,1-2H3,(H2,17,18,19,20)/t8-,9-,23?/m1/s1 |
| InChIKey | CKQXWWXJHFTWJZ-BIJWWHILSA-N |
| XLogP | 2.15 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide?
The IUPAC name of 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide (CID 122185735) is 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide.
What is the SMILES notation for 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide?
The canonical SMILES for 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide is C[C@@H](O)[C@@H](C)Nc1nc(Nc2ccc(S(N)=O)cc2)ncc1Br.
What is the InChIKey of 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide?
The InChIKey is CKQXWWXJHFTWJZ-BIJWWHILSA-N. The full InChI is InChI=1S/C14H18BrN5O2S/c1-8(9(2)21)18-13-12(15)7-17-14(20-13)19-10-3-5-11(6-4-10)23(16)22/h3-9,21H,16H2,1-2H3,(H2,17,18,19,20)/t8-,9-,23?/m1/s1.
What are the key properties of 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide?
4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide has a molecular weight of 400.30 g/mol, XLogP of 2.15, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-bromo-4-[[(2R,3R)-3-hydroxybutan-2-yl]amino]pyrimidin-2-yl]amino]benzenesulfinamide is sourced from PubChem (CID 122185735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).