About 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol
4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol (PubChem CID 122186118) has the molecular formula C17H13F2N3O
and a molecular weight of 313.31 g/mol. Its IUPAC name is 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol.
Molecular Properties
| Compound Name | 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol |
| PubChem CID | 122186118 |
| Molecular Formula | C17H13F2N3O |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol |
| SMILES | Cc1ccc(-c2nc(N)ncc2-c2cc(F)c(O)c(F)c2)cc1 |
| InChI | InChI=1S/C17H13F2N3O/c1-9-2-4-10(5-3-9)15-12(8-21-17(20)22-15)11-6-13(18)16(23)14(19)7-11/h2-8,23H,1H3,(H2,20,21,22) |
| InChIKey | HPQKQSNTXXYIDR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol?
The IUPAC name of 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol (CID 122186118) is 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol.
What is the SMILES notation for 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol?
The canonical SMILES for 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol is Cc1ccc(-c2nc(N)ncc2-c2cc(F)c(O)c(F)c2)cc1.
What is the InChIKey of 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol?
The InChIKey is HPQKQSNTXXYIDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2N3O/c1-9-2-4-10(5-3-9)15-12(8-21-17(20)22-15)11-6-13(18)16(23)14(19)7-11/h2-8,23H,1H3,(H2,20,21,22).
What are the key properties of 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol?
4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol has a molecular weight of 313.31 g/mol, XLogP of 3.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-amino-4-(4-methylphenyl)pyrimidin-5-yl]-2,6-difluorophenol is sourced from PubChem (CID 122186118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).