C17H16N6O — CID 122186139
N-[3-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]phenyl]prop-2-enamide (PubChem CID 122186139) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is N-[3-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122186139 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[3-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nccc(Nc3cc(C)[nH]n3)n2)c1 |
| InChI | InChI=1S/C17H16N6O/c1-3-16(24)19-13-6-4-5-12(10-13)17-18-8-7-14(21-17)20-15-9-11(2)22-23-15/h3-10H,1H2,2H3,(H,19,24)(H2,18,20,21,22,23) |
| InChIKey | XXOBXNIDTITKIH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|