C26H22N4O2 — CID 122186187
ethyl 5-(benzimidazol-1-ylmethyl)-1,3-diphenylpyrazole-4-carboxylate (PubChem CID 122186187) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is ethyl 5-(benzimidazol-1-ylmethyl)-1,3-diphenylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-(benzimidazol-1-ylmethyl)-1,3-diphenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 122186187 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | ethyl 5-(benzimidazol-1-ylmethyl)-1,3-diphenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)nn(-c2ccccc2)c1Cn1cnc2ccccc21 |
| InChI | InChI=1S/C26H22N4O2/c1-2-32-26(31)24-23(17-29-18-27-21-15-9-10-16-22(21)29)30(20-13-7-4-8-14-20)28-25(24)19-11-5-3-6-12-19/h3-16,18H,2,17H2,1H3 |
| InChIKey | ACJFLLGRMFZZLW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |