About 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine
3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine (PubChem CID 122186253) has the molecular formula C31H22N2O2S
and a molecular weight of 486.60 g/mol. Its IUPAC name is 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine |
| PubChem CID | 122186253 |
| Molecular Formula | C31H22N2O2S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine |
| SMILES | Nc1ncc(-c2ccc(Oc3ccccc3)cc2)c2scc(-c3ccc(Oc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C31H22N2O2S/c32-31-29-28(22-13-17-26(18-14-22)35-24-9-5-2-6-10-24)20-36-30(29)27(19-33-31)21-11-15-25(16-12-21)34-23-7-3-1-4-8-23/h1-20H,(H2,32,33) |
| InChIKey | MRGGMXQUCMYMCG-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine?
The IUPAC name of 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine (CID 122186253) is 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine.
What is the SMILES notation for 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine?
The canonical SMILES for 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine is Nc1ncc(-c2ccc(Oc3ccccc3)cc2)c2scc(-c3ccc(Oc4ccccc4)cc3)c12.
What is the InChIKey of 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine?
The InChIKey is MRGGMXQUCMYMCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H22N2O2S/c32-31-29-28(22-13-17-26(18-14-22)35-24-9-5-2-6-10-24)20-36-30(29)27(19-33-31)21-11-15-25(16-12-21)34-23-7-3-1-4-8-23/h1-20H,(H2,32,33).
What are the key properties of 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine?
3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine has a molecular weight of 486.60 g/mol, XLogP of 8.80, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-bis(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine is sourced from PubChem (CID 122186253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).