About 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine
7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine (PubChem CID 122186260) has the molecular formula C26H24N4O2S
and a molecular weight of 456.57 g/mol. Its IUPAC name is 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine |
| PubChem CID | 122186260 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine |
| SMILES | COCCCn1cc(-c2cnc(N)c3c(-c4ccc(Oc5ccccc5)cc4)csc23)cn1 |
| InChI | InChI=1S/C26H24N4O2S/c1-31-13-5-12-30-16-19(14-29-30)22-15-28-26(27)24-23(17-33-25(22)24)18-8-10-21(11-9-18)32-20-6-3-2-4-7-20/h2-4,6-11,14-17H,5,12-13H2,1H3,(H2,27,28) |
| InChIKey | ULABSGNAHJEKRI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine?
The IUPAC name of 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine (CID 122186260) is 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine.
What is the SMILES notation for 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine?
The canonical SMILES for 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine is COCCCn1cc(-c2cnc(N)c3c(-c4ccc(Oc5ccccc5)cc4)csc23)cn1.
What is the InChIKey of 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine?
The InChIKey is ULABSGNAHJEKRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N4O2S/c1-31-13-5-12-30-16-19(14-29-30)22-15-28-26(27)24-23(17-33-25(22)24)18-8-10-21(11-9-18)32-20-6-3-2-4-7-20/h2-4,6-11,14-17H,5,12-13H2,1H3,(H2,27,28).
What are the key properties of 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine?
7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine has a molecular weight of 456.57 g/mol, XLogP of 6.24, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-(3-methoxypropyl)pyrazol-4-yl]-3-(4-phenoxyphenyl)thieno[3,2-c]pyridin-4-amine is sourced from PubChem (CID 122186260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).