C27H27F4N5O4 — CID 122186277
6-[[[1-[2-[3-fluoro-6-(2,2,2-trifluoroethoxy)-1,5-naphthyridin-4-yl]ethyl]-2-oxabicyclo[2.2.2]octan-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 122186277) has the molecular formula C27H27F4N5O4 and a molecular weight of 561.54 g/mol. Its IUPAC name is 6-[[[1-[2-[3-fluoro-6-(2,2,2-trifluoroethoxy)-1,5-naphthyridin-4-yl]ethyl]-2-oxabicyclo[2.2.2]octan-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[[[1-[2-[3-fluoro-6-(2,2,2-trifluoroethoxy)-1,5-naphthyridin-4-yl]ethyl]-2-oxabicyclo[2.2.2]octan-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 122186277 |
| Molecular Formula | C27H27F4N5O4 |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 6-[[[1-[2-[3-fluoro-6-(2,2,2-trifluoroethoxy)-1,5-naphthyridin-4-yl]ethyl]-2-oxabicyclo[2.2.2]octan-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2ccc(CNC34CCC(CCc5c(F)cnc6ccc(OCC(F)(F)F)nc56)(CC3)OC4)nc2N1 |
| InChI | InChI=1S/C27H27F4N5O4/c28-18-12-32-19-2-4-22(39-15-27(29,30)31)36-23(19)17(18)5-6-26-9-7-25(8-10-26,14-40-26)33-11-16-1-3-20-24(34-16)35-21(37)13-38-20/h1-4,12,33H,5-11,13-15H2,(H,34,35,37) |
| InChIKey | FNMQWAJVVVNDOF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |