C27H28FN5O — CID 122186376
3-[5-[(1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-yl]-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 122186376) has the molecular formula C27H28FN5O and a molecular weight of 457.55 g/mol. Its IUPAC name is 3-[5-[(1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-yl]-1H-1,2,4-triazol-3-yl]aniline.
| Compound Name | 3-[5-[(1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-yl]-1H-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 122186376 |
| Molecular Formula | C27H28FN5O |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 3-[5-[(1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-yl]-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | CN(C)CCC[C@@]1(c2ccc(F)cc2)OCc2cc(-c3nc(-c4cccc(N)c4)n[nH]3)ccc21 |
| InChI | InChI=1S/C27H28FN5O/c1-33(2)14-4-13-27(21-8-10-22(28)11-9-21)24-12-7-19(15-20(24)17-34-27)26-30-25(31-32-26)18-5-3-6-23(29)16-18/h3,5-12,15-16H,4,13-14,17,29H2,1-2H3,(H,30,31,32)/t27-/m0/s1 |
| InChIKey | ZKRFQLDCABQAKG-MHZLTWQESA-N |
| XLogP | 4.98 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|