C27H26FN5O3 — CID 122186381
3-[(1S)-1-(4-fluorophenyl)-5-[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine (PubChem CID 122186381) has the molecular formula C27H26FN5O3 and a molecular weight of 487.54 g/mol. Its IUPAC name is 3-[(1S)-1-(4-fluorophenyl)-5-[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(1S)-1-(4-fluorophenyl)-5-[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 122186381 |
| Molecular Formula | C27H26FN5O3 |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 3-[(1S)-1-(4-fluorophenyl)-5-[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC[C@@]1(c2ccc(F)cc2)OCc2cc(-c3n[nH]c(-c4ccccc4[N+](=O)[O-])n3)ccc21 |
| InChI | InChI=1S/C27H26FN5O3/c1-32(2)15-5-14-27(20-9-11-21(28)12-10-20)23-13-8-18(16-19(23)17-36-27)25-29-26(31-30-25)22-6-3-4-7-24(22)33(34)35/h3-4,6-13,16H,5,14-15,17H2,1-2H3,(H,29,30,31)/t27-/m0/s1 |
| InChIKey | TUGGBJUJIAYJLI-MHZLTWQESA-N |
| XLogP | 5.30 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|