C30H32I2N4 — CID 122186423
2-methyl-5-[6-(2-methylpyrido[4,3-b]indol-2-ium-5-yl)hexyl]pyrido[4,3-b]indol-2-ium diiodide (PubChem CID 122186423) has the molecular formula C30H32I2N4 and a molecular weight of 702.42 g/mol. Its IUPAC name is 2-methyl-5-[6-(2-methylpyrido[4,3-b]indol-2-ium-5-yl)hexyl]pyrido[4,3-b]indol-2-ium diiodide.
| Compound Name | 2-methyl-5-[6-(2-methylpyrido[4,3-b]indol-2-ium-5-yl)hexyl]pyrido[4,3-b]indol-2-ium diiodide |
|---|---|
| PubChem CID | 122186423 |
| Molecular Formula | C30H32I2N4 |
| Molecular Weight | 702.42 g/mol |
| Exact Mass | 702.07 |
| IUPAC Name | 2-methyl-5-[6-(2-methylpyrido[4,3-b]indol-2-ium-5-yl)hexyl]pyrido[4,3-b]indol-2-ium diiodide |
| SMILES | C[n+]1ccc2c(c1)c1ccccc1n2CCCCCCn1c2ccccc2c2c[n+](C)ccc21.[I-].[I-] |
| InChI | InChI=1S/C30H32N4.2HI/c1-31-19-15-29-25(21-31)23-11-5-7-13-27(23)33(29)17-9-3-4-10-18-34-28-14-8-6-12-24(28)26-22-32(2)20-16-30(26)34;;/h5-8,11-16,19-22H,3-4,9-10,17-18H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | HVLBRSNGGVLOEK-UHFFFAOYSA-L |
| XLogP | -0.18 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.42 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|