C31H34I2N4 — CID 122186425
2-methyl-5-[7-(2-methylpyrido[4,3-b]indol-2-ium-5-yl)heptyl]pyrido[4,3-b]indol-2-ium diiodide (PubChem CID 122186425) has the molecular formula C31H34I2N4 and a molecular weight of 716.45 g/mol. Its IUPAC name is 2-methyl-5-[7-(2-methylpyrido[4,3-b]indol-2-ium-5-yl)heptyl]pyrido[4,3-b]indol-2-ium diiodide.
| Compound Name | 2-methyl-5-[7-(2-methylpyrido[4,3-b]indol-2-ium-5-yl)heptyl]pyrido[4,3-b]indol-2-ium diiodide |
|---|---|
| PubChem CID | 122186425 |
| Molecular Formula | C31H34I2N4 |
| Molecular Weight | 716.45 g/mol |
| Exact Mass | 716.09 |
| IUPAC Name | 2-methyl-5-[7-(2-methylpyrido[4,3-b]indol-2-ium-5-yl)heptyl]pyrido[4,3-b]indol-2-ium diiodide |
| SMILES | C[n+]1ccc2c(c1)c1ccccc1n2CCCCCCCn1c2ccccc2c2c[n+](C)ccc21.[I-].[I-] |
| InChI | InChI=1S/C31H34N4.2HI/c1-32-20-16-30-26(22-32)24-12-6-8-14-28(24)34(30)18-10-4-3-5-11-19-35-29-15-9-7-13-25(29)27-23-33(2)21-17-31(27)35;;/h6-9,12-17,20-23H,3-5,10-11,18-19H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | PFKUKLVQUNQDPK-UHFFFAOYSA-L |
| XLogP | 0.21 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|