C35H42I2N4O2 — CID 122186435
2-[5-[9-[2-(2-hydroxyethyl)pyrido[4,3-b]indol-2-ium-5-yl]nonyl]pyrido[4,3-b]indol-2-ium-2-yl]ethanol diiodide (PubChem CID 122186435) has the molecular formula C35H42I2N4O2 and a molecular weight of 804.56 g/mol. Its IUPAC name is 2-[5-[9-[2-(2-hydroxyethyl)pyrido[4,3-b]indol-2-ium-5-yl]nonyl]pyrido[4,3-b]indol-2-ium-2-yl]ethanol diiodide.
| Compound Name | 2-[5-[9-[2-(2-hydroxyethyl)pyrido[4,3-b]indol-2-ium-5-yl]nonyl]pyrido[4,3-b]indol-2-ium-2-yl]ethanol diiodide |
|---|---|
| PubChem CID | 122186435 |
| Molecular Formula | C35H42I2N4O2 |
| Molecular Weight | 804.56 g/mol |
| Exact Mass | 804.14 |
| IUPAC Name | 2-[5-[9-[2-(2-hydroxyethyl)pyrido[4,3-b]indol-2-ium-5-yl]nonyl]pyrido[4,3-b]indol-2-ium-2-yl]ethanol diiodide |
| SMILES | OCC[n+]1ccc2c(c1)c1ccccc1n2CCCCCCCCCn1c2ccccc2c2c[n+](CCO)ccc21.[I-].[I-] |
| InChI | InChI=1S/C35H42N4O2.2HI/c40-24-22-36-20-16-34-30(26-36)28-12-6-8-14-32(28)38(34)18-10-4-2-1-3-5-11-19-39-33-15-9-7-13-29(33)31-27-37(23-25-41)21-17-35(31)39;;/h6-9,12-17,20-21,26-27,40-41H,1-5,10-11,18-19,22-25H2;2*1H/q+2;;/p-2 |
| InChIKey | PMUWDIDEHFRKTL-UHFFFAOYSA-L |
| XLogP | -0.10 |
| TPSA | 58.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.56 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|