C23H23N5O — CID 122186483
N-(2-aminophenyl)-4-[[[(5S)-5-phenyl-4,5-dihydro-1H-imidazol-2-yl]amino]methyl]benzamide (PubChem CID 122186483) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[(5S)-5-phenyl-4,5-dihydro-1H-imidazol-2-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[(5S)-5-phenyl-4,5-dihydro-1H-imidazol-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 122186483 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[(5S)-5-phenyl-4,5-dihydro-1H-imidazol-2-yl]amino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC2=NC[C@H](c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C23H23N5O/c24-19-8-4-5-9-20(19)27-22(29)18-12-10-16(11-13-18)14-25-23-26-15-21(28-23)17-6-2-1-3-7-17/h1-13,21H,14-15,24H2,(H,27,29)(H2,25,26,28)/t21-/m1/s1 |
| InChIKey | ICQCMPQEFWZGRJ-OAQYLSRUSA-N |
| XLogP | 3.31 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|