C24H23N3O2S — CID 122186544
N-(2-aminophenyl)-4-[[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]sulfanylmethyl]benzamide (PubChem CID 122186544) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 122186544 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-(2-aminophenyl)-4-[[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]sulfanylmethyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CSC2=N[C@@H](Cc3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C24H23N3O2S/c25-21-8-4-5-9-22(21)27-23(28)19-12-10-18(11-13-19)16-30-24-26-20(15-29-24)14-17-6-2-1-3-7-17/h1-13,20H,14-16,25H2,(H,27,28)/t20-/m0/s1 |
| InChIKey | NZBHFBGHVBAHOW-FQEVSTJZSA-N |
| XLogP | 4.75 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|