C22H26O — CID 122186591
(2E,6E)-3,7-dimethyl-8-(4-phenylphenyl)octa-2,6-dien-1-ol (PubChem CID 122186591) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is (2E,6E)-3,7-dimethyl-8-(4-phenylphenyl)octa-2,6-dien-1-ol.
| Compound Name | (2E,6E)-3,7-dimethyl-8-(4-phenylphenyl)octa-2,6-dien-1-ol |
|---|---|
| PubChem CID | 122186591 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (2E,6E)-3,7-dimethyl-8-(4-phenylphenyl)octa-2,6-dien-1-ol |
| SMILES | C/C(=C\CO)CC/C=C(\C)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26O/c1-18(15-16-23)7-6-8-19(2)17-20-11-13-22(14-12-20)21-9-4-3-5-10-21/h3-5,8-15,23H,6-7,16-17H2,1-2H3/b18-15+,19-8+ |
| InChIKey | BWZXNUHHRTYJKU-OCBACMADSA-N |
| XLogP | 5.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|