C27H34O — CID 122186592
(2E,6E,10E)-3,7,11-trimethyl-12-(4-phenylphenyl)dodeca-2,6,10-trien-1-ol (PubChem CID 122186592) has the molecular formula C27H34O and a molecular weight of 374.57 g/mol. Its IUPAC name is (2E,6E,10E)-3,7,11-trimethyl-12-(4-phenylphenyl)dodeca-2,6,10-trien-1-ol.
| Compound Name | (2E,6E,10E)-3,7,11-trimethyl-12-(4-phenylphenyl)dodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 122186592 |
| Molecular Formula | C27H34O |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (2E,6E,10E)-3,7,11-trimethyl-12-(4-phenylphenyl)dodeca-2,6,10-trien-1-ol |
| SMILES | C/C(=C\CO)CC/C=C(\C)CC/C=C(\C)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H34O/c1-22(9-7-11-23(2)19-20-28)10-8-12-24(3)21-25-15-17-27(18-16-25)26-13-5-4-6-14-26/h4-6,9,12-19,28H,7-8,10-11,20-21H2,1-3H3/b22-9+,23-19+,24-12+ |
| InChIKey | QSBGLCPILUAUCH-WXCJWQIYSA-N |
| XLogP | 7.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|