C25H26N4 — CID 122186653
1-[5-(4-methylphenyl)-1H-imidazol-2-yl]-N-(quinolin-6-ylmethyl)cyclopentan-1-amine (PubChem CID 122186653) has the molecular formula C25H26N4 and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-[5-(4-methylphenyl)-1H-imidazol-2-yl]-N-(quinolin-6-ylmethyl)cyclopentan-1-amine.
| Compound Name | 1-[5-(4-methylphenyl)-1H-imidazol-2-yl]-N-(quinolin-6-ylmethyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 122186653 |
| Molecular Formula | C25H26N4 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-[5-(4-methylphenyl)-1H-imidazol-2-yl]-N-(quinolin-6-ylmethyl)cyclopentan-1-amine |
| SMILES | Cc1ccc(-c2cnc(C3(NCc4ccc5ncccc5c4)CCCC3)[nH]2)cc1 |
| InChI | InChI=1S/C25H26N4/c1-18-6-9-20(10-7-18)23-17-27-24(29-23)25(12-2-3-13-25)28-16-19-8-11-22-21(15-19)5-4-14-26-22/h4-11,14-15,17,28H,2-3,12-13,16H2,1H3,(H,27,29) |
| InChIKey | ZOTZPKYIRMXEJK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |