C17H15N3O6S — CID 122186703
N-hydroxy-4-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoylamino]benzamide (PubChem CID 122186703) has the molecular formula C17H15N3O6S and a molecular weight of 389.39 g/mol. Its IUPAC name is N-hydroxy-4-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoylamino]benzamide.
| Compound Name | N-hydroxy-4-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 122186703 |
| Molecular Formula | C17H15N3O6S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-hydroxy-4-[3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoylamino]benzamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2S1(=O)=O)Nc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C17H15N3O6S/c21-15(18-12-7-5-11(6-8-12)16(22)19-24)9-10-20-17(23)13-3-1-2-4-14(13)27(20,25)26/h1-8,24H,9-10H2,(H,18,21)(H,19,22) |
| InChIKey | ZYZKSMWFEWUHDU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|