C22H17N3O6S — CID 122186719
4-[(6-benzamido-1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]-N-hydroxybenzamide (PubChem CID 122186719) has the molecular formula C22H17N3O6S and a molecular weight of 451.46 g/mol. Its IUPAC name is 4-[(6-benzamido-1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]-N-hydroxybenzamide.
| Compound Name | 4-[(6-benzamido-1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 122186719 |
| Molecular Formula | C22H17N3O6S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 4-[(6-benzamido-1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)c3ccc(NC(=O)c4ccccc4)cc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C22H17N3O6S/c26-20(15-4-2-1-3-5-15)23-17-10-11-18-19(12-17)32(30,31)25(22(18)28)13-14-6-8-16(9-7-14)21(27)24-29/h1-12,29H,13H2,(H,23,26)(H,24,27) |
| InChIKey | JMFYEXIWBDMYSJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|