C24H16N6O4 — CID 122186828
2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6-diphenyl-1,2,4-triazin-3-one (PubChem CID 122186828) has the molecular formula C24H16N6O4 and a molecular weight of 452.43 g/mol. Its IUPAC name is 2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6-diphenyl-1,2,4-triazin-3-one.
| Compound Name | 2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6-diphenyl-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 122186828 |
| Molecular Formula | C24H16N6O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-5,6-diphenyl-1,2,4-triazin-3-one |
| SMILES | O=c1nc(-c2ccccc2)c(-c2ccccc2)nn1Cc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C24H16N6O4/c31-24-25-21(16-7-3-1-4-8-16)22(17-9-5-2-6-10-17)28-29(24)15-20-26-27-23(34-20)18-11-13-19(14-12-18)30(32)33/h1-14H,15H2 |
| InChIKey | LCPYSDJBXZLZLO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 129.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|