C16H16ClN3 — CID 122186927
(1R,2R,4R)-2-[5-(2-chloro-4-pyridinyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane (PubChem CID 122186927) has the molecular formula C16H16ClN3 and a molecular weight of 285.78 g/mol. Its IUPAC name is (1R,2R,4R)-2-[5-(2-chloro-4-pyridinyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4R)-2-[5-(2-chloro-4-pyridinyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 122186927 |
| Molecular Formula | C16H16ClN3 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (1R,2R,4R)-2-[5-(2-chloro-4-pyridinyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane |
| SMILES | Clc1cc(-c2cncc([C@H]3C[C@H]4CC[C@H]3N4)c2)ccn1 |
| InChI | InChI=1S/C16H16ClN3/c17-16-6-10(3-4-19-16)11-5-12(9-18-8-11)14-7-13-1-2-15(14)20-13/h3-6,8-9,13-15,20H,1-2,7H2/t13-,14-,15-/m1/s1 |
| InChIKey | SDONYPAESJRRLK-RBSFLKMASA-N |
| XLogP | 3.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|