C16H17N3 — CID 122186930
(1R,2R,4R)-2-(5-pyridin-3-yl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane (PubChem CID 122186930) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (1R,2R,4R)-2-(5-pyridin-3-yl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4R)-2-(5-pyridin-3-yl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 122186930 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (1R,2R,4R)-2-(5-pyridin-3-yl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane |
| SMILES | c1cncc(-c2cncc([C@H]3C[C@H]4CC[C@H]3N4)c2)c1 |
| InChI | InChI=1S/C16H17N3/c1-2-11(8-17-5-1)12-6-13(10-18-9-12)15-7-14-3-4-16(15)19-14/h1-2,5-6,8-10,14-16,19H,3-4,7H2/t14-,15-,16-/m1/s1 |
| InChIKey | KPVBKZCVLOWIBI-BZUAXINKSA-N |
| XLogP | 2.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |