C22H36O7 — CID 122187008
[(1S,2R,4aS,8S,8aR)-5-(3,5-dihydroxy-3-methylpentyl)-2,8-dihydroxy-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate (PubChem CID 122187008) has the molecular formula C22H36O7 and a molecular weight of 412.52 g/mol. Its IUPAC name is [(1S,2R,4aS,8S,8aR)-5-(3,5-dihydroxy-3-methylpentyl)-2,8-dihydroxy-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1S,2R,4aS,8S,8aR)-5-(3,5-dihydroxy-3-methylpentyl)-2,8-dihydroxy-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 122187008 |
| Molecular Formula | C22H36O7 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | [(1S,2R,4aS,8S,8aR)-5-(3,5-dihydroxy-3-methylpentyl)-2,8-dihydroxy-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)[C@H](O)CC[C@]2(C)C(CCC(C)(O)CCO)=C(C)C(=O)[C@@H](O)[C@@H]12 |
| InChI | InChI=1S/C22H36O7/c1-13-15(6-8-20(3,28)10-11-23)21(4)9-7-16(25)22(5,12-29-14(2)24)19(21)18(27)17(13)26/h16,18-19,23,25,27-28H,6-12H2,1-5H3/t16-,18-,19-,20?,21-,22+/m1/s1 |
| InChIKey | CCKUOYDCCGWXEK-PZYGZVTGSA-N |
| XLogP | 1.51 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |