C24H38O8 — CID 122187011
[(1S,2R,4aS,8S,8aR)-8-acetyloxy-5-(3,5-dihydroxy-3-methylpentyl)-2-hydroxy-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate (PubChem CID 122187011) has the molecular formula C24H38O8 and a molecular weight of 454.56 g/mol. Its IUPAC name is [(1S,2R,4aS,8S,8aR)-8-acetyloxy-5-(3,5-dihydroxy-3-methylpentyl)-2-hydroxy-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1S,2R,4aS,8S,8aR)-8-acetyloxy-5-(3,5-dihydroxy-3-methylpentyl)-2-hydroxy-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 122187011 |
| Molecular Formula | C24H38O8 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | [(1S,2R,4aS,8S,8aR)-8-acetyloxy-5-(3,5-dihydroxy-3-methylpentyl)-2-hydroxy-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)[C@H](O)CC[C@]2(C)C(CCC(C)(O)CCO)=C(C)C(=O)[C@@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C24H38O8/c1-14-17(7-9-22(4,30)11-12-25)23(5)10-8-18(28)24(6,13-31-15(2)26)21(23)20(19(14)29)32-16(3)27/h18,20-21,25,28,30H,7-13H2,1-6H3/t18-,20-,21-,22?,23-,24+/m1/s1 |
| InChIKey | SGWHOCKDQUUVNF-SDTSKVPRSA-N |
| XLogP | 2.08 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |