C26H40O9 — CID 122187012
[(1S,2R,4aS,8S,8aR)-2,8-diacetyloxy-5-(3,5-dihydroxy-3-methylpentyl)-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate (PubChem CID 122187012) has the molecular formula C26H40O9 and a molecular weight of 496.60 g/mol. Its IUPAC name is [(1S,2R,4aS,8S,8aR)-2,8-diacetyloxy-5-(3,5-dihydroxy-3-methylpentyl)-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1S,2R,4aS,8S,8aR)-2,8-diacetyloxy-5-(3,5-dihydroxy-3-methylpentyl)-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 122187012 |
| Molecular Formula | C26H40O9 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | [(1S,2R,4aS,8S,8aR)-2,8-diacetyloxy-5-(3,5-dihydroxy-3-methylpentyl)-1,4a,6-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)[C@H](OC(C)=O)CC[C@]2(C)C(CCC(C)(O)CCO)=C(C)C(=O)[C@@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C26H40O9/c1-15-19(8-10-24(5,32)12-13-27)25(6)11-9-20(34-17(3)29)26(7,14-33-16(2)28)23(25)22(21(15)31)35-18(4)30/h20,22-23,27,32H,8-14H2,1-7H3/t20-,22-,23-,24?,25-,26+/m1/s1 |
| InChIKey | XMJCMUGHDGHZBN-FNMNNZMESA-N |
| XLogP | 2.65 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|