C27H42O6 — CID 122187022
[(2S,3R,4R,5R)-5-[[(1S,4aR,4bS,7S,10aR)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4-dihydroxyoxolan-2-yl]methyl acetate (PubChem CID 122187022) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-[[(1S,4aR,4bS,7S,10aR)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4-dihydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R)-5-[[(1S,4aR,4bS,7S,10aR)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4-dihydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122187022 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | [(2S,3R,4R,5R)-5-[[(1S,4aR,4bS,7S,10aR)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| SMILES | C=C[C@@]1(C)CC[C@H]2C(=CC[C@H]3[C@@](C)(CO[C@@H]4O[C@@H](COC(C)=O)[C@H](O)[C@H]4O)CCC[C@]23C)C1 |
| InChI | InChI=1S/C27H42O6/c1-6-25(3)13-10-19-18(14-25)8-9-21-26(4,11-7-12-27(19,21)5)16-32-24-23(30)22(29)20(33-24)15-31-17(2)28/h6,8,19-24,29-30H,1,7,9-16H2,2-5H3/t19-,20-,21-,22-,23+,24+,25-,26+,27+/m0/s1 |
| InChIKey | HBZZAIWGPLKKMJ-OYMKYVHCSA-N |
| XLogP | 4.15 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|