About ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate
ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate (PubChem CID 122187133) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 122187133 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c3ccccc3n(Cc3ccncc3)c2cn1 |
| InChI | InChI=1S/C20H17N3O2/c1-2-25-20(24)17-11-16-15-5-3-4-6-18(15)23(19(16)12-22-17)13-14-7-9-21-10-8-14/h3-12H,2,13H2,1H3 |
| InChIKey | JYSCFBWYTYFPQN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate (CID 122187133) is ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate is CCOC(=O)c1cc2c3ccccc3n(Cc3ccncc3)c2cn1.
What is the InChIKey of ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is JYSCFBWYTYFPQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2/c1-2-25-20(24)17-11-16-15-5-3-4-6-18(15)23(19(16)12-22-17)13-14-7-9-21-10-8-14/h3-12H,2,13H2,1H3.
What are the key properties of ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate?
ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 331.38 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9-(pyridin-4-ylmethyl)pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 122187133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).