C11H20O7S — CID 122187138
(2S)-3-methyl-2-[[(2S,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylsulfanyl]butanoic acid (PubChem CID 122187138) has the molecular formula C11H20O7S and a molecular weight of 296.34 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2S,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylsulfanyl]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(2S,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 122187138 |
| Molecular Formula | C11H20O7S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (2S)-3-methyl-2-[[(2S,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylsulfanyl]butanoic acid |
| SMILES | CC(C)[C@H](SC[C@@]1(O)OC[C@@H](O)[C@@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C11H20O7S/c1-5(2)8(10(15)16)19-4-11(17)9(14)7(13)6(12)3-18-11/h5-9,12-14,17H,3-4H2,1-2H3,(H,15,16)/t6-,7-,8+,9+,11-/m1/s1 |
| InChIKey | WMUAVVSFUOBCEJ-LSQHKTNHSA-N |
| XLogP | -1.37 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |