About 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide
5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide (PubChem CID 122187176) has the molecular formula C8H8N2O3S2
and a molecular weight of 244.30 g/mol. Its IUPAC name is 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide |
| PubChem CID | 122187176 |
| Molecular Formula | C8H8N2O3S2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide |
| SMILES | Cc1ncc(-c2ccc(S(N)(=O)=O)s2)o1 |
| InChI | InChI=1S/C8H8N2O3S2/c1-5-10-4-6(13-5)7-2-3-8(14-7)15(9,11)12/h2-4H,1H3,(H2,9,11,12) |
| InChIKey | KJEWGNVFHSWLJZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide?
The IUPAC name of 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide (CID 122187176) is 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide?
The canonical SMILES for 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide is Cc1ncc(-c2ccc(S(N)(=O)=O)s2)o1.
What is the InChIKey of 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide?
The InChIKey is KJEWGNVFHSWLJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S2/c1-5-10-4-6(13-5)7-2-3-8(14-7)15(9,11)12/h2-4H,1H3,(H2,9,11,12).
What are the key properties of 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide?
5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide has a molecular weight of 244.30 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-1,3-oxazol-5-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 122187176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).