C23H16F3NO2 — CID 122187189
1-methyl-4-phenyl-3-[4-(trifluoromethyl)phenyl]-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione (PubChem CID 122187189) has the molecular formula C23H16F3NO2 and a molecular weight of 395.38 g/mol. Its IUPAC name is 1-methyl-4-phenyl-3-[4-(trifluoromethyl)phenyl]-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione.
| Compound Name | 1-methyl-4-phenyl-3-[4-(trifluoromethyl)phenyl]-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione |
|---|---|
| PubChem CID | 122187189 |
| Molecular Formula | C23H16F3NO2 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-methyl-4-phenyl-3-[4-(trifluoromethyl)phenyl]-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione |
| SMILES | CN1C(=O)C(c2ccc(C(F)(F)F)cc2)=C(c2ccccc2)C12C=CC(=O)C=C2 |
| InChI | InChI=1S/C23H16F3NO2/c1-27-21(29)19(15-7-9-17(10-8-15)23(24,25)26)20(16-5-3-2-4-6-16)22(27)13-11-18(28)12-14-22/h2-14H,1H3 |
| InChIKey | WJKGPPVMYJAKOH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|