C23H17NO3 — CID 122187197
4-(1-methyl-2,8-dioxo-4-phenyl-1-azaspiro[4.5]deca-3,6,9-trien-3-yl)benzaldehyde (PubChem CID 122187197) has the molecular formula C23H17NO3 and a molecular weight of 355.39 g/mol. Its IUPAC name is 4-(1-methyl-2,8-dioxo-4-phenyl-1-azaspiro[4.5]deca-3,6,9-trien-3-yl)benzaldehyde.
| Compound Name | 4-(1-methyl-2,8-dioxo-4-phenyl-1-azaspiro[4.5]deca-3,6,9-trien-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 122187197 |
| Molecular Formula | C23H17NO3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-(1-methyl-2,8-dioxo-4-phenyl-1-azaspiro[4.5]deca-3,6,9-trien-3-yl)benzaldehyde |
| SMILES | CN1C(=O)C(c2ccc(C=O)cc2)=C(c2ccccc2)C12C=CC(=O)C=C2 |
| InChI | InChI=1S/C23H17NO3/c1-24-22(27)20(17-9-7-16(15-25)8-10-17)21(18-5-3-2-4-6-18)23(24)13-11-19(26)12-14-23/h2-15H,1H3 |
| InChIKey | AOZVHXDKPSAUAE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|