C23H19NO3 — CID 122187199
3-(4-methoxyphenyl)-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione (PubChem CID 122187199) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione.
| Compound Name | 3-(4-methoxyphenyl)-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione |
|---|---|
| PubChem CID | 122187199 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione |
| SMILES | COc1ccc(C2=C(c3ccccc3)C3(C=CC(=O)C=C3)N(C)C2=O)cc1 |
| InChI | InChI=1S/C23H19NO3/c1-24-22(26)20(16-8-10-19(27-2)11-9-16)21(17-6-4-3-5-7-17)23(24)14-12-18(25)13-15-23/h3-15H,1-2H3 |
| InChIKey | PQIWGXIFUMAULJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|