About 1-cyclohexylnona-2,4-diyne-1,6-diol
1-cyclohexylnona-2,4-diyne-1,6-diol (PubChem CID 122187217) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-cyclohexylnona-2,4-diyne-1,6-diol.
Molecular Properties
| Compound Name | 1-cyclohexylnona-2,4-diyne-1,6-diol |
| PubChem CID | 122187217 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1-cyclohexylnona-2,4-diyne-1,6-diol |
| SMILES | CCCC(O)C#CC#CC(O)C1CCCCC1 |
| InChI | InChI=1S/C15H22O2/c1-2-8-14(16)11-6-7-12-15(17)13-9-4-3-5-10-13/h13-17H,2-5,8-10H2,1H3 |
| InChIKey | IKPIOGXDZLDYAO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylnona-2,4-diyne-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylnona-2,4-diyne-1,6-diol?
The IUPAC name of 1-cyclohexylnona-2,4-diyne-1,6-diol (CID 122187217) is 1-cyclohexylnona-2,4-diyne-1,6-diol.
What is the SMILES notation for 1-cyclohexylnona-2,4-diyne-1,6-diol?
The canonical SMILES for 1-cyclohexylnona-2,4-diyne-1,6-diol is CCCC(O)C#CC#CC(O)C1CCCCC1.
What is the InChIKey of 1-cyclohexylnona-2,4-diyne-1,6-diol?
The InChIKey is IKPIOGXDZLDYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-2-8-14(16)11-6-7-12-15(17)13-9-4-3-5-10-13/h13-17H,2-5,8-10H2,1H3.
What are the key properties of 1-cyclohexylnona-2,4-diyne-1,6-diol?
1-cyclohexylnona-2,4-diyne-1,6-diol has a molecular weight of 234.34 g/mol, XLogP of 2.10, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylnona-2,4-diyne-1,6-diol is sourced from PubChem (CID 122187217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).