About 2-methyltetradeca-5,7-diyne-4,9-diol
2-methyltetradeca-5,7-diyne-4,9-diol (PubChem CID 122187221) has the molecular formula C15H24O2
and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-methyltetradeca-5,7-diyne-4,9-diol.
Molecular Properties
| Compound Name | 2-methyltetradeca-5,7-diyne-4,9-diol |
| PubChem CID | 122187221 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-methyltetradeca-5,7-diyne-4,9-diol |
| SMILES | CCCCCC(O)C#CC#CC(O)CC(C)C |
| InChI | InChI=1S/C15H24O2/c1-4-5-6-9-14(16)10-7-8-11-15(17)12-13(2)3/h13-17H,4-6,9,12H2,1-3H3 |
| InChIKey | DRSKNUKUKIBZIL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyltetradeca-5,7-diyne-4,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyltetradeca-5,7-diyne-4,9-diol?
The IUPAC name of 2-methyltetradeca-5,7-diyne-4,9-diol (CID 122187221) is 2-methyltetradeca-5,7-diyne-4,9-diol.
What is the SMILES notation for 2-methyltetradeca-5,7-diyne-4,9-diol?
The canonical SMILES for 2-methyltetradeca-5,7-diyne-4,9-diol is CCCCCC(O)C#CC#CC(O)CC(C)C.
What is the InChIKey of 2-methyltetradeca-5,7-diyne-4,9-diol?
The InChIKey is DRSKNUKUKIBZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-4-5-6-9-14(16)10-7-8-11-15(17)12-13(2)3/h13-17H,4-6,9,12H2,1-3H3.
What are the key properties of 2-methyltetradeca-5,7-diyne-4,9-diol?
2-methyltetradeca-5,7-diyne-4,9-diol has a molecular weight of 236.36 g/mol, XLogP of 2.34, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyltetradeca-5,7-diyne-4,9-diol is sourced from PubChem (CID 122187221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).