About 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one
6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one (PubChem CID 122187442) has the molecular formula C27H17N3OS
and a molecular weight of 431.52 g/mol. Its IUPAC name is 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one.
Molecular Properties
| Compound Name | 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one |
| PubChem CID | 122187442 |
| Molecular Formula | C27H17N3OS |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one |
| SMILES | O=c1c2ccccc2[nH]c2c(-c3c(-c4cccs4)[nH]c4ccccc34)c3ccccc3n12 |
| InChI | InChI=1S/C27H17N3OS/c31-27-17-9-2-5-12-20(17)29-26-24(18-10-3-6-13-21(18)30(26)27)23-16-8-1-4-11-19(16)28-25(23)22-14-7-15-32-22/h1-15,28-29H |
| InChIKey | PWYDTQJPYDLTRY-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 53.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one?
The IUPAC name of 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one (CID 122187442) is 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one.
What is the SMILES notation for 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one?
The canonical SMILES for 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one is O=c1c2ccccc2[nH]c2c(-c3c(-c4cccs4)[nH]c4ccccc34)c3ccccc3n12.
What is the InChIKey of 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one?
The InChIKey is PWYDTQJPYDLTRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H17N3OS/c31-27-17-9-2-5-12-20(17)29-26-24(18-10-3-6-13-21(18)30(26)27)23-16-8-1-4-11-19(16)28-25(23)22-14-7-15-32-22/h1-15,28-29H.
What are the key properties of 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one?
6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one has a molecular weight of 431.52 g/mol, XLogP of 6.81, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-thiophen-2-yl-1H-indol-3-yl)-5H-indolo[2,1-b]quinazolin-12-one is sourced from PubChem (CID 122187442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).