About 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline
3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline (PubChem CID 122187544) has the molecular formula C14H10N4S2
and a molecular weight of 298.40 g/mol. Its IUPAC name is 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline.
Molecular Properties
| Compound Name | 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline |
| PubChem CID | 122187544 |
| Molecular Formula | C14H10N4S2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline |
| SMILES | Nc1cccc(-c2cn3nc(-c4cccs4)sc3n2)c1 |
| InChI | InChI=1S/C14H10N4S2/c15-10-4-1-3-9(7-10)11-8-18-14(16-11)20-13(17-18)12-5-2-6-19-12/h1-8H,15H2 |
| InChIKey | KFZNYIGZBSRZDD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline?
The IUPAC name of 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline (CID 122187544) is 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline.
What is the SMILES notation for 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline?
The canonical SMILES for 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline is Nc1cccc(-c2cn3nc(-c4cccs4)sc3n2)c1.
What is the InChIKey of 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline?
The InChIKey is KFZNYIGZBSRZDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4S2/c15-10-4-1-3-9(7-10)11-8-18-14(16-11)20-13(17-18)12-5-2-6-19-12/h1-8H,15H2.
What are the key properties of 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline?
3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline has a molecular weight of 298.40 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline is sourced from PubChem (CID 122187544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).