C17H13ClN4S — CID 122187547
3-[2-[(4-chlorophenyl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]aniline (PubChem CID 122187547) has the molecular formula C17H13ClN4S and a molecular weight of 340.84 g/mol. Its IUPAC name is 3-[2-[(4-chlorophenyl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]aniline.
| Compound Name | 3-[2-[(4-chlorophenyl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]aniline |
|---|---|
| PubChem CID | 122187547 |
| Molecular Formula | C17H13ClN4S |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-[2-[(4-chlorophenyl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-6-yl]aniline |
| SMILES | Nc1cccc(-c2cn3nc(Cc4ccc(Cl)cc4)sc3n2)c1 |
| InChI | InChI=1S/C17H13ClN4S/c18-13-6-4-11(5-7-13)8-16-21-22-10-15(20-17(22)23-16)12-2-1-3-14(19)9-12/h1-7,9-10H,8,19H2 |
| InChIKey | NEFCGPBPVWGZIV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|