About benzyl N-sulfamoyloxycarbamate
benzyl N-sulfamoyloxycarbamate (PubChem CID 122187596) has the molecular formula C8H10N2O5S
and a molecular weight of 246.24 g/mol. Its IUPAC name is benzyl N-sulfamoyloxycarbamate.
Molecular Properties
| Compound Name | benzyl N-sulfamoyloxycarbamate |
| PubChem CID | 122187596 |
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | benzyl N-sulfamoyloxycarbamate |
| SMILES | NS(=O)(=O)ONC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C8H10N2O5S/c9-16(12,13)15-10-8(11)14-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,11)(H2,9,12,13) |
| InChIKey | GUJZEGLJDZAUGK-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-sulfamoyloxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-sulfamoyloxycarbamate?
The IUPAC name of benzyl N-sulfamoyloxycarbamate (CID 122187596) is benzyl N-sulfamoyloxycarbamate.
What is the SMILES notation for benzyl N-sulfamoyloxycarbamate?
The canonical SMILES for benzyl N-sulfamoyloxycarbamate is NS(=O)(=O)ONC(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-sulfamoyloxycarbamate?
The InChIKey is GUJZEGLJDZAUGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O5S/c9-16(12,13)15-10-8(11)14-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,11)(H2,9,12,13).
What are the key properties of benzyl N-sulfamoyloxycarbamate?
benzyl N-sulfamoyloxycarbamate has a molecular weight of 246.24 g/mol, XLogP of 0.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-sulfamoyloxycarbamate is sourced from PubChem (CID 122187596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).