C22H20O3Se — CID 122187677
2,2-dimethyl-3-(4-methylphenyl)selanyl-3,4-dihydrobenzo[h]chromene-5,6-dione (PubChem CID 122187677) has the molecular formula C22H20O3Se and a molecular weight of 411.36 g/mol. Its IUPAC name is 2,2-dimethyl-3-(4-methylphenyl)selanyl-3,4-dihydrobenzo[h]chromene-5,6-dione.
| Compound Name | 2,2-dimethyl-3-(4-methylphenyl)selanyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
|---|---|
| PubChem CID | 122187677 |
| Molecular Formula | C22H20O3Se |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2,2-dimethyl-3-(4-methylphenyl)selanyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
| SMILES | Cc1ccc([Se]C2CC3=C(OC2(C)C)c2ccccc2C(=O)C3=O)cc1 |
| InChI | InChI=1S/C22H20O3Se/c1-13-8-10-14(11-9-13)26-18-12-17-20(24)19(23)15-6-4-5-7-16(15)21(17)25-22(18,2)3/h4-11,18H,12H2,1-3H3 |
| InChIKey | CUAJPFMTSQUMCC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|