C22H20O3S — CID 122187683
3-benzylsulfanyl-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione (PubChem CID 122187683) has the molecular formula C22H20O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-benzylsulfanyl-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione.
| Compound Name | 3-benzylsulfanyl-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
|---|---|
| PubChem CID | 122187683 |
| Molecular Formula | C22H20O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-benzylsulfanyl-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
| SMILES | CC1(C)OC2=C(CC1SCc1ccccc1)C(=O)C(=O)c1ccccc12 |
| InChI | InChI=1S/C22H20O3S/c1-22(2)18(26-13-14-8-4-3-5-9-14)12-17-20(24)19(23)15-10-6-7-11-16(15)21(17)25-22/h3-11,18H,12-13H2,1-2H3 |
| InChIKey | RJMWHRTZXBLHNQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|