C21H18O3S — CID 122187684
2,2-dimethyl-3-phenylsulfanyl-3,4-dihydrobenzo[h]chromene-5,6-dione (PubChem CID 122187684) has the molecular formula C21H18O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2,2-dimethyl-3-phenylsulfanyl-3,4-dihydrobenzo[h]chromene-5,6-dione.
| Compound Name | 2,2-dimethyl-3-phenylsulfanyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
|---|---|
| PubChem CID | 122187684 |
| Molecular Formula | C21H18O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2,2-dimethyl-3-phenylsulfanyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
| SMILES | CC1(C)OC2=C(CC1Sc1ccccc1)C(=O)C(=O)c1ccccc12 |
| InChI | InChI=1S/C21H18O3S/c1-21(2)17(25-13-8-4-3-5-9-13)12-16-19(23)18(22)14-10-6-7-11-15(14)20(16)24-21/h3-11,17H,12H2,1-2H3 |
| InChIKey | YPMRQCFLHXEFQA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|