C29H32O5 — CID 122187713
7-hydroxy-6,6-bis(3-methylbut-2-enyl)-8-(2-methylpropanoyl)-4-phenylchromene-2,5-dione (PubChem CID 122187713) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is 7-hydroxy-6,6-bis(3-methylbut-2-enyl)-8-(2-methylpropanoyl)-4-phenylchromene-2,5-dione.
| Compound Name | 7-hydroxy-6,6-bis(3-methylbut-2-enyl)-8-(2-methylpropanoyl)-4-phenylchromene-2,5-dione |
|---|---|
| PubChem CID | 122187713 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 7-hydroxy-6,6-bis(3-methylbut-2-enyl)-8-(2-methylpropanoyl)-4-phenylchromene-2,5-dione |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)c2c(-c3ccccc3)cc(=O)oc2C(C(=O)C(C)C)=C1O |
| InChI | InChI=1S/C29H32O5/c1-17(2)12-14-29(15-13-18(3)4)27(32)23-21(20-10-8-7-9-11-20)16-22(30)34-26(23)24(28(29)33)25(31)19(5)6/h7-13,16,19,33H,14-15H2,1-6H3 |
| InChIKey | UFJPDZLQLLTRAS-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|