C18H19N5O3 — CID 122187742
1-[(2R,10bS)-2-methoxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-pyrazin-2-ylurea (PubChem CID 122187742) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-[(2R,10bS)-2-methoxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-pyrazin-2-ylurea.
| Compound Name | 1-[(2R,10bS)-2-methoxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-pyrazin-2-ylurea |
|---|---|
| PubChem CID | 122187742 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-[(2R,10bS)-2-methoxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-pyrazin-2-ylurea |
| SMILES | CO[C@@H]1CCN2C(=O)c3cccc(NC(=O)Nc4cnccn4)c3[C@@H]2C1 |
| InChI | InChI=1S/C18H19N5O3/c1-26-11-5-8-23-14(9-11)16-12(17(23)24)3-2-4-13(16)21-18(25)22-15-10-19-6-7-20-15/h2-4,6-7,10-11,14H,5,8-9H2,1H3,(H2,20,21,22,25)/t11-,14+/m1/s1 |
| InChIKey | VRSPGAKIMFTTJM-RISCZKNCSA-N |
| XLogP | 2.43 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |