C17H17N5O3 — CID 122187743
1-[(2R,10bS)-2-hydroxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-pyrazin-2-ylurea (PubChem CID 122187743) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 1-[(2R,10bS)-2-hydroxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-pyrazin-2-ylurea.
| Compound Name | 1-[(2R,10bS)-2-hydroxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-pyrazin-2-ylurea |
|---|---|
| PubChem CID | 122187743 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-[(2R,10bS)-2-hydroxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-pyrazin-2-ylurea |
| SMILES | O=C(Nc1cnccn1)Nc1cccc2c1[C@@H]1C[C@H](O)CCN1C2=O |
| InChI | InChI=1S/C17H17N5O3/c23-10-4-7-22-13(8-10)15-11(16(22)24)2-1-3-12(15)20-17(25)21-14-9-18-5-6-19-14/h1-3,5-6,9-10,13,23H,4,7-8H2,(H2,19,20,21,25)/t10-,13+/m1/s1 |
| InChIKey | PFDVIMSWMQLRQB-MFKMUULPSA-N |
| XLogP | 1.77 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |