C20H22N4O3 — CID 122187748
1-[(2R,10bS)-2-methoxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-(3-methyl-2-pyridinyl)urea (PubChem CID 122187748) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-[(2R,10bS)-2-methoxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-(3-methyl-2-pyridinyl)urea.
| Compound Name | 1-[(2R,10bS)-2-methoxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-(3-methyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 122187748 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[(2R,10bS)-2-methoxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-(3-methyl-2-pyridinyl)urea |
| SMILES | CO[C@@H]1CCN2C(=O)c3cccc(NC(=O)Nc4ncccc4C)c3[C@@H]2C1 |
| InChI | InChI=1S/C20H22N4O3/c1-12-5-4-9-21-18(12)23-20(26)22-15-7-3-6-14-17(15)16-11-13(27-2)8-10-24(16)19(14)25/h3-7,9,13,16H,8,10-11H2,1-2H3,(H2,21,22,23,26)/t13-,16+/m1/s1 |
| InChIKey | VZHXSJJDXKRQMN-CJNGLKHVSA-N |
| XLogP | 3.34 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |