C15H22O4 — CID 122187758
(3S,4aR,5R,6R,7R,8R)-6,7,8-trihydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 122187758) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (3S,4aR,5R,6R,7R,8R)-6,7,8-trihydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (3S,4aR,5R,6R,7R,8R)-6,7,8-trihydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 122187758 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3S,4aR,5R,6R,7R,8R)-6,7,8-trihydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | C=C(C)[C@@H]1C[C@@]2(C)C(=CC1=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]2C |
| InChI | InChI=1S/C15H22O4/c1-7(2)9-6-15(4)8(3)12(17)14(19)13(18)10(15)5-11(9)16/h5,8-9,12-14,17-19H,1,6H2,2-4H3/t8-,9-,12+,13+,14+,15+/m0/s1 |
| InChIKey | UUTDDCCHVKTGBI-DNGGIMRHSA-N |
| XLogP | 0.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|