C20H34O5 — CID 122187829
(1R,2R,3E,5R,7S,10R,11R,12R,13S,14S)-3,6,6,10,14-pentamethyltricyclo[10.3.0.05,7]pentadec-3-ene-1,2,10,11,13-pentol (PubChem CID 122187829) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (1R,2R,3E,5R,7S,10R,11R,12R,13S,14S)-3,6,6,10,14-pentamethyltricyclo[10.3.0.05,7]pentadec-3-ene-1,2,10,11,13-pentol.
| Compound Name | (1R,2R,3E,5R,7S,10R,11R,12R,13S,14S)-3,6,6,10,14-pentamethyltricyclo[10.3.0.05,7]pentadec-3-ene-1,2,10,11,13-pentol |
|---|---|
| PubChem CID | 122187829 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (1R,2R,3E,5R,7S,10R,11R,12R,13S,14S)-3,6,6,10,14-pentamethyltricyclo[10.3.0.05,7]pentadec-3-ene-1,2,10,11,13-pentol |
| SMILES | C/C1=C\[C@@H]2[C@H](CC[C@@](C)(O)[C@H](O)[C@H]3[C@@H](O)[C@@H](C)C[C@]3(O)[C@@H]1O)C2(C)C |
| InChI | InChI=1S/C20H34O5/c1-10-8-13-12(18(13,3)4)6-7-19(5,24)17(23)14-15(21)11(2)9-20(14,25)16(10)22/h8,11-17,21-25H,6-7,9H2,1-5H3/b10-8+/t11-,12-,13+,14+,15-,16+,17+,19+,20+/m0/s1 |
| InChIKey | LLZBUQKJOMLRBO-AWKCRDMSSA-N |
| XLogP | 1.22 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|